C20H27N3O5 — CID 67249527
3-O-tert-butyl 10-O-ethyl 6-oxo-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,5]benzodiazepine-3,10-dicarboxylate (PubChem CID 67249527) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 3-O-tert-butyl 10-O-ethyl 6-oxo-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,5]benzodiazepine-3,10-dicarboxylate.
| Compound Name | 3-O-tert-butyl 10-O-ethyl 6-oxo-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,5]benzodiazepine-3,10-dicarboxylate |
|---|---|
| PubChem CID | 67249527 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 3-O-tert-butyl 10-O-ethyl 6-oxo-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,5]benzodiazepine-3,10-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)N1CCN(C(=O)OC(C)(C)C)CC1CC(=O)N2 |
| InChI | InChI=1S/C20H27N3O5/c1-5-27-18(25)13-6-7-15-16(10-13)23-9-8-22(19(26)28-20(2,3)4)12-14(23)11-17(24)21-15/h6-7,10,14H,5,8-9,11-12H2,1-4H3,(H,21,24) |
| InChIKey | VGXVSBLDEDMULX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |