C16H21BrN4O3 — CID 178002077
tert-butyl 5-bromo-9-oxo-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-13-carboxylate (PubChem CID 178002077) has the molecular formula C16H21BrN4O3 and a molecular weight of 397.27 g/mol. Its IUPAC name is tert-butyl 5-bromo-9-oxo-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-13-carboxylate.
| Compound Name | tert-butyl 5-bromo-9-oxo-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-13-carboxylate |
|---|---|
| PubChem CID | 178002077 |
| Molecular Formula | C16H21BrN4O3 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | tert-butyl 5-bromo-9-oxo-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-13-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3ncc(Br)cc3NC(=O)CC2C1 |
| InChI | InChI=1S/C16H21BrN4O3/c1-16(2,3)24-15(23)20-4-5-21-11(9-20)7-13(22)19-12-6-10(17)8-18-14(12)21/h6,8,11H,4-5,7,9H2,1-3H3,(H,19,22) |
| InChIKey | FQYQWZAHTVFMAT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |