C18H26BrN3O3 — CID 90781891
bromomethane;tert-butyl 6-oxo-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,5]benzodiazepine-3-carboxylate (PubChem CID 90781891) has the molecular formula C18H26BrN3O3 and a molecular weight of 412.33 g/mol. Its IUPAC name is bromomethane;tert-butyl 6-oxo-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,5]benzodiazepine-3-carboxylate.
| Compound Name | bromomethane;tert-butyl 6-oxo-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,5]benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 90781891 |
| Molecular Formula | C18H26BrN3O3 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | bromomethane;tert-butyl 6-oxo-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,5]benzodiazepine-3-carboxylate |
| SMILES | CBr.CC(C)(C)OC(=O)N1CCN2c3ccccc3NC(=O)CC2C1 |
| InChI | InChI=1S/C17H23N3O3.CH3Br/c1-17(2,3)23-16(22)19-8-9-20-12(11-19)10-15(21)18-13-6-4-5-7-14(13)20;1-2/h4-7,12H,8-11H2,1-3H3,(H,18,21);1H3 |
| InChIKey | FXKISQICSUHDCB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|