C18H23N3O2 — CID 124567123
tert-butyl (7R)-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene-5-carboxylate (PubChem CID 124567123) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is tert-butyl (7R)-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene-5-carboxylate.
| Compound Name | tert-butyl (7R)-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 124567123 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | tert-butyl (7R)-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3cccc4[nH]cc(c34)C[C@@H]2C1 |
| InChI | InChI=1S/C18H23N3O2/c1-18(2,3)23-17(22)20-7-8-21-13(11-20)9-12-10-19-14-5-4-6-15(21)16(12)14/h4-6,10,13,19H,7-9,11H2,1-3H3/t13-/m1/s1 |
| InChIKey | ZQTKNJFREZWTSF-CYBMUJFWSA-N |
| XLogP | 3.15 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |