C17H25N3O2 — CID 67001664
tert-butyl 2,4,4a,5,6,7-hexahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine-3-carboxylate (PubChem CID 67001664) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is tert-butyl 2,4,4a,5,6,7-hexahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine-3-carboxylate.
| Compound Name | tert-butyl 2,4,4a,5,6,7-hexahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 67001664 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | tert-butyl 2,4,4a,5,6,7-hexahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3ccccc3CNCC2C1 |
| InChI | InChI=1S/C17H25N3O2/c1-17(2,3)22-16(21)19-8-9-20-14(12-19)11-18-10-13-6-4-5-7-15(13)20/h4-7,14,18H,8-12H2,1-3H3 |
| InChIKey | OZZUGNPUUMGJHI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |