C16H25N3O3S — CID 158736085
tert-butyl (3S)-3-carbamoyl-4-phenylpiperazine-1-carboxylate;sulfane (PubChem CID 158736085) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is tert-butyl (3S)-3-carbamoyl-4-phenylpiperazine-1-carboxylate;sulfane.
| Compound Name | tert-butyl (3S)-3-carbamoyl-4-phenylpiperazine-1-carboxylate;sulfane |
|---|---|
| PubChem CID | 158736085 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | tert-butyl (3S)-3-carbamoyl-4-phenylpiperazine-1-carboxylate;sulfane |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccccc2)[C@H](C(N)=O)C1.S |
| InChI | InChI=1S/C16H23N3O3.H2S/c1-16(2,3)22-15(21)18-9-10-19(13(11-18)14(17)20)12-7-5-4-6-8-12;/h4-8,13H,9-11H2,1-3H3,(H2,17,20);1H2/t13-;/m0./s1 |
| InChIKey | ILRSKQZHSSKSPM-ZOWNYOTGSA-N |
| XLogP | 1.71 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |