C18H25ClN2O4 — CID 175358515
tert-butyl 3-chloro-4-(4-ethoxycarbonylphenyl)piperazine-1-carboxylate (PubChem CID 175358515) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is tert-butyl 3-chloro-4-(4-ethoxycarbonylphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-chloro-4-(4-ethoxycarbonylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175358515 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | tert-butyl 3-chloro-4-(4-ethoxycarbonylphenyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2Cl)cc1 |
| InChI | InChI=1S/C18H25ClN2O4/c1-5-24-16(22)13-6-8-14(9-7-13)21-11-10-20(12-15(21)19)17(23)25-18(2,3)4/h6-9,15H,5,10-12H2,1-4H3 |
| InChIKey | KEEVVQLXSYUYQS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|