C19H17F3N4O3 — CID 166082658
benzyl (10R)-9-oxo-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-12-carboxylate (PubChem CID 166082658) has the molecular formula C19H17F3N4O3 and a molecular weight of 406.36 g/mol. Its IUPAC name is benzyl (10R)-9-oxo-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-12-carboxylate.
| Compound Name | benzyl (10R)-9-oxo-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 166082658 |
| Molecular Formula | C19H17F3N4O3 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | benzyl (10R)-9-oxo-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-12-carboxylate |
| SMILES | O=C1Nc2cc(C(F)(F)F)cnc2N2CCN(C(=O)OCc3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C19H17F3N4O3/c20-19(21,22)13-8-14-16(23-9-13)26-7-6-25(10-15(26)17(27)24-14)18(28)29-11-12-4-2-1-3-5-12/h1-5,8-9,15H,6-7,10-11H2,(H,24,27)/t15-/m1/s1 |
| InChIKey | XNUKOYXXJFUPCD-OAHLLOKOSA-N |
| XLogP | 2.88 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |