C22H23N3O4 — CID 56856547
benzyl (7S,9aR)-7-benzyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate (PubChem CID 56856547) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is benzyl (7S,9aR)-7-benzyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate.
| Compound Name | benzyl (7S,9aR)-7-benzyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 56856547 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | benzyl (7S,9aR)-7-benzyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate |
| SMILES | O=C1N[C@@H](Cc2ccccc2)C(=O)N2CCN(C(=O)OCc3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C22H23N3O4/c26-20-19-14-24(22(28)29-15-17-9-5-2-6-10-17)11-12-25(19)21(27)18(23-20)13-16-7-3-1-4-8-16/h1-10,18-19H,11-15H2,(H,23,26)/t18-,19+/m0/s1 |
| InChIKey | QMIYARVPGVADNM-RBUKOAKNSA-N |
| XLogP | 1.58 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |