C19H22N3O5- — CID 11885856
5-[(7S,9aS)-7-benzyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-5-oxopentanoate (PubChem CID 11885856) has the molecular formula C19H22N3O5- and a molecular weight of 372.40 g/mol. Its IUPAC name is 5-[(7S,9aS)-7-benzyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-5-oxopentanoate.
| Compound Name | 5-[(7S,9aS)-7-benzyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 11885856 |
| Molecular Formula | C19H22N3O5- |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 5-[(7S,9aS)-7-benzyl-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-5-oxopentanoate |
| SMILES | O=C([O-])CCCC(=O)N1CCN2C(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C19H23N3O5/c23-16(7-4-8-17(24)25)21-9-10-22-15(12-21)18(26)20-14(19(22)27)11-13-5-2-1-3-6-13/h1-3,5-6,14-15H,4,7-12H2,(H,20,26)(H,24,25)/p-1/t14-,15-/m0/s1 |
| InChIKey | GWUWBPHMGPTDBQ-GJZGRUSLSA-M |
| XLogP | -1.31 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |