C17H22N4O3 — CID 78455039
2-(2-aminopropanoyl)-7-benzyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 78455039) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-(2-aminopropanoyl)-7-benzyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | 2-(2-aminopropanoyl)-7-benzyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 78455039 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-(2-aminopropanoyl)-7-benzyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CC(N)C(=O)N1CCN2C(=O)C(Cc3ccccc3)NC(=O)C2C1 |
| InChI | InChI=1S/C17H22N4O3/c1-11(18)16(23)20-7-8-21-14(10-20)15(22)19-13(17(21)24)9-12-5-3-2-4-6-12/h2-6,11,13-14H,7-10,18H2,1H3,(H,19,22) |
| InChIKey | RYZXKNSXOGUJSJ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |