C31H35N5O4 — CID 20769418
7-benzyl-2-[2-(4-benzylpiperazin-1-yl)-1-(furan-2-yl)-2-oxoethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 20769418) has the molecular formula C31H35N5O4 and a molecular weight of 541.65 g/mol. Its IUPAC name is 7-benzyl-2-[2-(4-benzylpiperazin-1-yl)-1-(furan-2-yl)-2-oxoethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | 7-benzyl-2-[2-(4-benzylpiperazin-1-yl)-1-(furan-2-yl)-2-oxoethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 20769418 |
| Molecular Formula | C31H35N5O4 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | 7-benzyl-2-[2-(4-benzylpiperazin-1-yl)-1-(furan-2-yl)-2-oxoethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1NC(Cc2ccccc2)C(=O)N2CCN(C(C(=O)N3CCN(Cc4ccccc4)CC3)c3ccco3)CC12 |
| InChI | InChI=1S/C31H35N5O4/c37-29-26-22-35(17-18-36(26)30(38)25(32-29)20-23-8-3-1-4-9-23)28(27-12-7-19-40-27)31(39)34-15-13-33(14-16-34)21-24-10-5-2-6-11-24/h1-12,19,25-26,28H,13-18,20-22H2,(H,32,37) |
| InChIKey | XMGUXMWCDPDCDJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |