C17H21F3N4O2 — CID 167173525
(11R)-13-butanoyl-8-methyl-5-(trifluoromethyl)-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-9-one (PubChem CID 167173525) has the molecular formula C17H21F3N4O2 and a molecular weight of 370.38 g/mol. Its IUPAC name is (11R)-13-butanoyl-8-methyl-5-(trifluoromethyl)-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-9-one.
| Compound Name | (11R)-13-butanoyl-8-methyl-5-(trifluoromethyl)-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 167173525 |
| Molecular Formula | C17H21F3N4O2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (11R)-13-butanoyl-8-methyl-5-(trifluoromethyl)-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-9-one |
| SMILES | CCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3N(C)C(=O)C[C@@H]2C1 |
| InChI | InChI=1S/C17H21F3N4O2/c1-3-4-14(25)23-5-6-24-12(10-23)8-15(26)22(2)13-7-11(17(18,19)20)9-21-16(13)24/h7,9,12H,3-6,8,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | OGQQOMIKTLQEGU-GFCCVEGCSA-N |
| XLogP | 2.28 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |