C23H24F6N7O4Si — CID 174157246
CID 174157246 (PubChem CID 174157246) has the molecular formula C23H24F6N7O4Si and a molecular weight of 604.56 g/mol.
| Compound Name | CID 174157246 |
|---|---|
| PubChem CID | 174157246 |
| Molecular Formula | C23H24F6N7O4Si |
| Molecular Weight | 604.56 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | — |
| SMILES | CN1C(=O)[C@H]2CN(C(=O)CCOC[C@](C)([Si])Nc3cn[nH]c(=O)c3C(F)(F)F)CCN2c2ncc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C23H24F6N7O4Si/c1-21(41,32-13-9-31-33-19(38)17(13)23(27,28)29)11-40-6-3-16(37)35-4-5-36-15(10-35)20(39)34(2)14-7-12(22(24,25)26)8-30-18(14)36/h7-9,15H,3-6,10-11H2,1-2H3,(H2,32,33,38)/t15-,21+/m1/s1 |
| InChIKey | AYQHLXZZUFGFSJ-VFNWGFHPSA-N |
| XLogP | 1.60 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.56 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|