C23H26F6N6O4 — CID 167192248
4-[[(2R)-1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 167192248) has the molecular formula C23H26F6N6O4 and a molecular weight of 564.49 g/mol. Its IUPAC name is 4-[[(2R)-1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-[[(2R)-1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 167192248 |
| Molecular Formula | C23H26F6N6O4 |
| Molecular Weight | 564.49 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 4-[[(2R)-1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | C[C@H](COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3OCCC2C1)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C23H26F6N6O4/c1-13(32-16-10-31-33-21(37)19(16)23(27,28)29)12-38-6-3-18(36)34-4-5-35-15(11-34)2-7-39-17-8-14(22(24,25)26)9-30-20(17)35/h8-10,13,15H,2-7,11-12H2,1H3,(H2,32,33,37)/t13-,15?/m1/s1 |
| InChIKey | XMCPQWOHGFWFEE-AFYYWNPRSA-N |
| XLogP | 2.91 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|