C22H25F6N7O4 — CID 167192687
4-[[(2S)-1-[3-oxo-3-[(11R)-5-(trifluoromethyl)-8-oxa-1,3,6,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2,4,6-trien-13-yl]propoxy]propan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 167192687) has the molecular formula C22H25F6N7O4 and a molecular weight of 565.48 g/mol. Its IUPAC name is 4-[[(2S)-1-[3-oxo-3-[(11R)-5-(trifluoromethyl)-8-oxa-1,3,6,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2,4,6-trien-13-yl]propoxy]propan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-[[(2S)-1-[3-oxo-3-[(11R)-5-(trifluoromethyl)-8-oxa-1,3,6,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2,4,6-trien-13-yl]propoxy]propan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 167192687 |
| Molecular Formula | C22H25F6N7O4 |
| Molecular Weight | 565.48 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 4-[[(2S)-1-[3-oxo-3-[(11R)-5-(trifluoromethyl)-8-oxa-1,3,6,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2,4,6-trien-13-yl]propoxy]propan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | C[C@@H](COCCC(=O)N1CCN2c3ncc(C(F)(F)F)nc3OCC[C@@H]2C1)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C22H25F6N7O4/c1-12(31-14-8-30-33-19(37)17(14)22(26,27)28)11-38-6-3-16(36)34-4-5-35-13(10-34)2-7-39-20-18(35)29-9-15(32-20)21(23,24)25/h8-9,12-13H,2-7,10-11H2,1H3,(H2,31,33,37)/t12-,13+/m0/s1 |
| InChIKey | ZBCPYOOKXWPKHD-QWHCGFSZSA-N |
| XLogP | 2.30 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|