C23H25F6N7O3S — CID 167192689
4-[1-[3-[8-methyl-9-sulfanylidene-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]-3-oxopropoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 167192689) has the molecular formula C23H25F6N7O3S and a molecular weight of 593.55 g/mol. Its IUPAC name is 4-[1-[3-[8-methyl-9-sulfanylidene-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]-3-oxopropoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-[1-[3-[8-methyl-9-sulfanylidene-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]-3-oxopropoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 167192689 |
| Molecular Formula | C23H25F6N7O3S |
| Molecular Weight | 593.55 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | 4-[1-[3-[8-methyl-9-sulfanylidene-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]-3-oxopropoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | CC(COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3N(C)C(=S)C2C1)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C23H25F6N7O3S/c1-12(32-14-9-31-33-20(38)18(14)23(27,28)29)11-39-6-3-17(37)35-4-5-36-16(10-35)21(40)34(2)15-7-13(22(24,25)26)8-30-19(15)36/h7-9,12,16H,3-6,10-11H2,1-2H3,(H2,32,33,38) |
| InChIKey | XQZVHQAATXQKJD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|