C22H24F6N8O4 — CID 164854767
(10R)-8-methyl-12-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]propanoyl]-5-(trifluoromethyl)-1,3,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one (PubChem CID 164854767) has the molecular formula C22H24F6N8O4 and a molecular weight of 578.47 g/mol. Its IUPAC name is (10R)-8-methyl-12-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]propanoyl]-5-(trifluoromethyl)-1,3,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one.
| Compound Name | (10R)-8-methyl-12-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]propanoyl]-5-(trifluoromethyl)-1,3,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 164854767 |
| Molecular Formula | C22H24F6N8O4 |
| Molecular Weight | 578.47 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | (10R)-8-methyl-12-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]propanoyl]-5-(trifluoromethyl)-1,3,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one |
| SMILES | C[C@@H](COCCC(=O)N1CCN2c3ncc(C(F)(F)F)nc3N(C)C(=O)[C@H]2C1)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C22H24F6N8O4/c1-11(31-12-7-30-33-19(38)16(12)22(26,27)28)10-40-6-3-15(37)35-4-5-36-13(9-35)20(39)34(2)18-17(36)29-8-14(32-18)21(23,24)25/h7-8,11,13H,3-6,9-10H2,1-2H3,(H2,31,33,38)/t11-,13+/m0/s1 |
| InChIKey | YREGNMFTOYALNW-WCQYABFASA-N |
| XLogP | 1.50 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|