C22H24F6N6O4 — CID 167242855
4-[1-[3-oxo-3-[(10R)-5-(trifluoromethyl)-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]propoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 167242855) has the molecular formula C22H24F6N6O4 and a molecular weight of 550.46 g/mol. Its IUPAC name is 4-[1-[3-oxo-3-[(10R)-5-(trifluoromethyl)-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]propoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-[1-[3-oxo-3-[(10R)-5-(trifluoromethyl)-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]propoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 167242855 |
| Molecular Formula | C22H24F6N6O4 |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | 4-[1-[3-oxo-3-[(10R)-5-(trifluoromethyl)-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]propoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | CC(COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3OC[C@H]2C1)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C22H24F6N6O4/c1-12(31-15-8-30-32-20(36)18(15)22(26,27)28)10-37-5-2-17(35)33-3-4-34-14(9-33)11-38-16-6-13(21(23,24)25)7-29-19(16)34/h6-8,12,14H,2-5,9-11H2,1H3,(H2,31,32,36)/t12?,14-/m1/s1 |
| InChIKey | HYSXVIKHLSSMJN-TYZXPVIJSA-N |
| XLogP | 2.52 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|