C21H23F6N7O4 — CID 167192655
4-[1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,6,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]propoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 167192655) has the molecular formula C21H23F6N7O4 and a molecular weight of 551.45 g/mol. Its IUPAC name is 4-[1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,6,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]propoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-[1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,6,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]propoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 167192655 |
| Molecular Formula | C21H23F6N7O4 |
| Molecular Weight | 551.45 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 4-[1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,6,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]propoxy]propan-2-ylamino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | CC(COCCC(=O)N1CCN2c3ncc(C(F)(F)F)nc3OCC2C1)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C21H23F6N7O4/c1-11(30-13-6-29-32-18(36)16(13)21(25,26)27)9-37-5-2-15(35)33-3-4-34-12(8-33)10-38-19-17(34)28-7-14(31-19)20(22,23)24/h6-7,11-12H,2-5,8-10H2,1H3,(H2,30,32,36) |
| InChIKey | IIXXNCPTHVRBGU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|