C23H25F6N6O4Si — CID 174157244
CID 174157244 (PubChem CID 174157244) has the molecular formula C23H25F6N6O4Si and a molecular weight of 591.57 g/mol.
| Compound Name | CID 174157244 |
|---|---|
| PubChem CID | 174157244 |
| Molecular Formula | C23H25F6N6O4Si |
| Molecular Weight | 591.57 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | — |
| SMILES | Cc1c(C(F)(F)F)cnc2c1OC[C@H]1CN(C(=O)CCOC[C@](C)([Si])Nc3cn[nH]c(=O)c3C(F)(F)F)CCN21 |
| InChI | InChI=1S/C23H25F6N6O4Si/c1-12-14(22(24,25)26)7-30-19-18(12)39-10-13-9-34(4-5-35(13)19)16(36)3-6-38-11-21(2,40)32-15-8-31-33-20(37)17(15)23(27,28)29/h7-8,13H,3-6,9-11H2,1-2H3,(H2,32,33,37)/t13-,21+/m1/s1 |
| InChIKey | BIWUJXYVYDWGDW-ASSNKEHSSA-N |
| XLogP | 2.32 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|