C28H26F6N6O4 — CID 167192578
4-[1-[[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]propoxy]methyl]-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 167192578) has the molecular formula C28H26F6N6O4 and a molecular weight of 624.54 g/mol. Its IUPAC name is 4-[1-[[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]propoxy]methyl]-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-[1-[[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]propoxy]methyl]-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 167192578 |
| Molecular Formula | C28H26F6N6O4 |
| Molecular Weight | 624.54 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 4-[1-[[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-12-yl]propoxy]methyl]-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | O=C(CCOCC1c2ccccc2CN1c1cn[nH]c(=O)c1C(F)(F)F)N1CCN2c3ncc(C(F)(F)F)cc3OCC2C1 |
| InChI | InChI=1S/C28H26F6N6O4/c29-27(30,31)17-9-22-25(35-10-17)39-7-6-38(13-18(39)14-44-22)23(41)5-8-43-15-21-19-4-2-1-3-16(19)12-40(21)20-11-36-37-26(42)24(20)28(32,33)34/h1-4,9-11,18,21H,5-8,12-15H2,(H,37,42) |
| InChIKey | WLLBEKCFYSXVGU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|