C24H27F6N5O6 — CID 177382563
4-[(2S)-1-methoxy-3-[3-oxo-3-[(11S)-5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-yl]oxy-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 177382563) has the molecular formula C24H27F6N5O6 and a molecular weight of 595.50 g/mol. Its IUPAC name is 4-[(2S)-1-methoxy-3-[3-oxo-3-[(11S)-5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-yl]oxy-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-[(2S)-1-methoxy-3-[3-oxo-3-[(11S)-5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-yl]oxy-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 177382563 |
| Molecular Formula | C24H27F6N5O6 |
| Molecular Weight | 595.50 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | 4-[(2S)-1-methoxy-3-[3-oxo-3-[(11S)-5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-yl]oxy-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | COC[C@@H](COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3OCC[C@H]2C1)Oc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C24H27F6N5O6/c1-38-12-16(41-18-10-32-33-22(37)20(18)24(28,29)30)13-39-6-3-19(36)34-4-5-35-15(11-34)2-7-40-17-8-14(23(25,26)27)9-31-21(17)35/h8-10,15-16H,2-7,11-13H2,1H3,(H,33,37)/t15-,16-/m0/s1 |
| InChIKey | XEJKFCWHBMFMHK-HOTGVXAUSA-N |
| XLogP | 2.50 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|