C23H27F5N6O4 — CID 167192320
5-(difluoromethyl)-4-[1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-ylamino]-1H-pyridazin-6-one (PubChem CID 167192320) has the molecular formula C23H27F5N6O4 and a molecular weight of 546.50 g/mol. Its IUPAC name is 5-(difluoromethyl)-4-[1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-ylamino]-1H-pyridazin-6-one.
| Compound Name | 5-(difluoromethyl)-4-[1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-ylamino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 167192320 |
| Molecular Formula | C23H27F5N6O4 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 5-(difluoromethyl)-4-[1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]propan-2-ylamino]-1H-pyridazin-6-one |
| SMILES | CC(COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3OCCC2C1)Nc1cn[nH]c(=O)c1C(F)F |
| InChI | InChI=1S/C23H27F5N6O4/c1-13(31-16-10-30-32-22(36)19(16)20(24)25)12-37-6-3-18(35)33-4-5-34-15(11-33)2-7-38-17-8-14(23(26,27)28)9-29-21(17)34/h8-10,13,15,20H,2-7,11-12H2,1H3,(H2,31,32,36) |
| InChIKey | AMMDRETYYDMGDR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|