C24H33F3N4O5 — CID 167192601
tert-butyl N-[(2S)-1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]but-3-en-2-yl]carbamate (PubChem CID 167192601) has the molecular formula C24H33F3N4O5 and a molecular weight of 514.55 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]but-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 167192601 |
| Molecular Formula | C24H33F3N4O5 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | tert-butyl N-[(2S)-1-[3-oxo-3-[5-(trifluoromethyl)-8-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]propoxy]but-3-en-2-yl]carbamate |
| SMILES | C=C[C@@H](COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3OCCC2C1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H33F3N4O5/c1-5-17(29-22(33)36-23(2,3)4)15-34-10-7-20(32)30-8-9-31-18(14-30)6-11-35-19-12-16(24(25,26)27)13-28-21(19)31/h5,12-13,17-18H,1,6-11,14-15H2,2-4H3,(H,29,33)/t17-,18?/m0/s1 |
| InChIKey | PCQIMEOIVFQBHK-ZENAZSQFSA-N |
| XLogP | 3.39 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|