C18H23F5N4O2 — CID 167173497
3-[(2S)-2-aminopropoxy]-1-[5,5-difluoro-3-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridin-8-yl]propan-1-one (PubChem CID 167173497) has the molecular formula C18H23F5N4O2 and a molecular weight of 422.40 g/mol. Its IUPAC name is 3-[(2S)-2-aminopropoxy]-1-[5,5-difluoro-3-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridin-8-yl]propan-1-one.
| Compound Name | 3-[(2S)-2-aminopropoxy]-1-[5,5-difluoro-3-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridin-8-yl]propan-1-one |
|---|---|
| PubChem CID | 167173497 |
| Molecular Formula | C18H23F5N4O2 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 3-[(2S)-2-aminopropoxy]-1-[5,5-difluoro-3-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridin-8-yl]propan-1-one |
| SMILES | C[C@H](N)COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3C(F)(F)CC2C1 |
| InChI | InChI=1S/C18H23F5N4O2/c1-11(24)10-29-5-2-15(28)26-3-4-27-13(9-26)7-17(19,20)14-6-12(18(21,22)23)8-25-16(14)27/h6,8,11,13H,2-5,7,9-10,24H2,1H3/t11-,13?/m0/s1 |
| InChIKey | AWGRBFTWPMGYFX-AMGKYWFPSA-N |
| XLogP | 2.37 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|