C24H31F6N7O4 — CID 172675589
9-methyl-13-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)diazinan-4-yl]amino]propoxy]propanoyl]-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-one (PubChem CID 172675589) has the molecular formula C24H31F6N7O4 and a molecular weight of 595.55 g/mol. Its IUPAC name is 9-methyl-13-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)diazinan-4-yl]amino]propoxy]propanoyl]-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-one.
| Compound Name | 9-methyl-13-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)diazinan-4-yl]amino]propoxy]propanoyl]-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 172675589 |
| Molecular Formula | C24H31F6N7O4 |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | 9-methyl-13-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)diazinan-4-yl]amino]propoxy]propanoyl]-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-one |
| SMILES | C[C@@H](COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3C(=O)N(C)CC2C1)NC1CNNC(=O)C1C(F)(F)F |
| InChI | InChI=1S/C24H31F6N7O4/c1-13(33-17-9-32-34-21(39)19(17)24(28,29)30)12-41-6-3-18(38)36-4-5-37-15(11-36)10-35(2)22(40)16-7-14(23(25,26)27)8-31-20(16)37/h7-8,13,15,17,19,32-33H,3-6,9-12H2,1-2H3,(H,34,39)/t13-,15?,17?,19?/m0/s1 |
| InChIKey | AJNAXCICFOYBOH-YHHJOVQNSA-N |
| XLogP | 0.77 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|