C26H31F6N7O3 — CID 170450659
4-[[(2S)-1-[3-[9-cyclopropyl-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]-3-oxopropoxy]propan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 170450659) has the molecular formula C26H31F6N7O3 and a molecular weight of 603.57 g/mol. Its IUPAC name is 4-[[(2S)-1-[3-[9-cyclopropyl-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]-3-oxopropoxy]propan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-[[(2S)-1-[3-[9-cyclopropyl-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]-3-oxopropoxy]propan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 170450659 |
| Molecular Formula | C26H31F6N7O3 |
| Molecular Weight | 603.57 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | 4-[[(2S)-1-[3-[9-cyclopropyl-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-13-yl]-3-oxopropoxy]propan-2-yl]amino]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | C[C@@H](COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3CN(C3CC3)CC2C1)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C26H31F6N7O3/c1-15(35-20-10-34-36-24(41)22(20)26(30,31)32)14-42-7-4-21(40)37-5-6-39-19(12-37)13-38(18-2-3-18)11-16-8-17(25(27,28)29)9-33-23(16)39/h8-10,15,18-19H,2-7,11-14H2,1H3,(H2,35,36,41)/t15-,19?/m0/s1 |
| InChIKey | UCYMNNDKLJSIKP-FUKCDUGKSA-N |
| XLogP | 3.11 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|