C23H29F6N7O4 — CID 172675588
13-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)diazinan-4-yl]amino]propoxy]propanoyl]-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-one (PubChem CID 172675588) has the molecular formula C23H29F6N7O4 and a molecular weight of 581.52 g/mol. Its IUPAC name is 13-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)diazinan-4-yl]amino]propoxy]propanoyl]-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-one.
| Compound Name | 13-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)diazinan-4-yl]amino]propoxy]propanoyl]-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 172675588 |
| Molecular Formula | C23H29F6N7O4 |
| Molecular Weight | 581.52 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | 13-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)diazinan-4-yl]amino]propoxy]propanoyl]-5-(trifluoromethyl)-1,3,9,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-one |
| SMILES | C[C@@H](COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3C(=O)NCC2C1)NC1CNNC(=O)C1C(F)(F)F |
| InChI | InChI=1S/C23H29F6N7O4/c1-12(33-16-9-32-34-21(39)18(16)23(27,28)29)11-40-5-2-17(37)35-3-4-36-14(10-35)8-31-20(38)15-6-13(22(24,25)26)7-30-19(15)36/h6-7,12,14,16,18,32-33H,2-5,8-11H2,1H3,(H,31,38)(H,34,39)/t12-,14?,16?,18?/m0/s1 |
| InChIKey | VVURAAXHDIYGFK-GBCJNWIQSA-N |
| XLogP | 0.43 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.52 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|