C17H23ClF3N3O2 — CID 55687925
1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-(2-methylpropoxy)propan-1-one (PubChem CID 55687925) has the molecular formula C17H23ClF3N3O2 and a molecular weight of 393.84 g/mol. Its IUPAC name is 1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-(2-methylpropoxy)propan-1-one.
| Compound Name | 1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-(2-methylpropoxy)propan-1-one |
|---|---|
| PubChem CID | 55687925 |
| Molecular Formula | C17H23ClF3N3O2 |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-(2-methylpropoxy)propan-1-one |
| SMILES | CC(C)COCCC(=O)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C17H23ClF3N3O2/c1-12(2)11-26-8-3-15(25)23-4-6-24(7-5-23)16-14(18)9-13(10-22-16)17(19,20)21/h9-10,12H,3-8,11H2,1-2H3 |
| InChIKey | KVYQMEOFFZFOQR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|