C15H21F3N4O3 — CID 146218314
3-[(2S)-2-hydroxypropoxy]-1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propan-1-one (PubChem CID 146218314) has the molecular formula C15H21F3N4O3 and a molecular weight of 362.35 g/mol. Its IUPAC name is 3-[(2S)-2-hydroxypropoxy]-1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-[(2S)-2-hydroxypropoxy]-1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 146218314 |
| Molecular Formula | C15H21F3N4O3 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-[(2S)-2-hydroxypropoxy]-1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propan-1-one |
| SMILES | C[C@H](O)COCCC(=O)N1CCN(c2ncc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C15H21F3N4O3/c1-11(23)10-25-7-2-13(24)21-3-5-22(6-4-21)14-19-8-12(9-20-14)15(16,17)18/h8-9,11,23H,2-7,10H2,1H3/t11-/m0/s1 |
| InChIKey | AKORHCWHIAGASJ-NSHDSACASA-N |
| XLogP | 0.93 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|