C15H22F3N5O2 — CID 146218844
3-[[(2S)-2-hydroxypropyl]amino]-1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propan-1-one (PubChem CID 146218844) has the molecular formula C15H22F3N5O2 and a molecular weight of 361.37 g/mol. Its IUPAC name is 3-[[(2S)-2-hydroxypropyl]amino]-1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-[[(2S)-2-hydroxypropyl]amino]-1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 146218844 |
| Molecular Formula | C15H22F3N5O2 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 3-[[(2S)-2-hydroxypropyl]amino]-1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propan-1-one |
| SMILES | C[C@H](O)CNCCC(=O)N1CCN(c2ncc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C15H22F3N5O2/c1-11(24)8-19-3-2-13(25)22-4-6-23(7-5-22)14-20-9-12(10-21-14)15(16,17)18/h9-11,19,24H,2-8H2,1H3/t11-/m0/s1 |
| InChIKey | LXECZUOMHMDACB-NSHDSACASA-N |
| XLogP | 0.50 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|