C15H21F3N6O4 — CID 174218118
1-[[2-oxo-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethoxy]amino]propan-2-ylcarbamic acid (PubChem CID 174218118) has the molecular formula C15H21F3N6O4 and a molecular weight of 406.37 g/mol. Its IUPAC name is 1-[[2-oxo-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethoxy]amino]propan-2-ylcarbamic acid.
| Compound Name | 1-[[2-oxo-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethoxy]amino]propan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 174218118 |
| Molecular Formula | C15H21F3N6O4 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-[[2-oxo-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethoxy]amino]propan-2-ylcarbamic acid |
| SMILES | CC(CNOCC(=O)N1CCN(c2ncc(C(F)(F)F)cn2)CC1)NC(=O)O |
| InChI | InChI=1S/C15H21F3N6O4/c1-10(22-14(26)27)6-21-28-9-12(25)23-2-4-24(5-3-23)13-19-7-11(8-20-13)15(16,17)18/h7-8,10,21-22H,2-6,9H2,1H3,(H,26,27) |
| InChIKey | RWNDIKDHWLMDFZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|