C20H29F3N6O4 — CID 170167700
tert-butyl-[(1E)-1-[2-oxo-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethoxy]iminobutan-2-yl]carbamic acid (PubChem CID 170167700) has the molecular formula C20H29F3N6O4 and a molecular weight of 474.48 g/mol. Its IUPAC name is tert-butyl-[(1E)-1-[2-oxo-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethoxy]iminobutan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(1E)-1-[2-oxo-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethoxy]iminobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 170167700 |
| Molecular Formula | C20H29F3N6O4 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | tert-butyl-[(1E)-1-[2-oxo-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethoxy]iminobutan-2-yl]carbamic acid |
| SMILES | CCC(/C=N/OCC(=O)N1CCN(c2ncc(C(F)(F)F)cn2)CC1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C20H29F3N6O4/c1-5-15(29(18(31)32)19(2,3)4)12-26-33-13-16(30)27-6-8-28(9-7-27)17-24-10-14(11-25-17)20(21,22)23/h10-12,15H,5-9,13H2,1-4H3,(H,31,32)/b26-12+ |
| InChIKey | BSNPXOLLNJOSCD-RPPGKUMJSA-N |
| XLogP | 2.70 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|