C14H21F3N6O2 — CID 174227916
2-(2-aminopropylamino)oxy-1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethanone (PubChem CID 174227916) has the molecular formula C14H21F3N6O2 and a molecular weight of 362.36 g/mol. Its IUPAC name is 2-(2-aminopropylamino)oxy-1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-(2-aminopropylamino)oxy-1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 174227916 |
| Molecular Formula | C14H21F3N6O2 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-(2-aminopropylamino)oxy-1-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethanone |
| SMILES | CC(N)CNOCC(=O)N1CCN(c2ncc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C14H21F3N6O2/c1-10(18)6-21-25-9-12(24)22-2-4-23(5-3-22)13-19-7-11(8-20-13)14(15,16)17/h7-8,10,21H,2-6,9,18H2,1H3 |
| InChIKey | HTYNEADTPMVQLF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|