C15H21N7O4 — CID 174218126
[(2S)-1-[[2-[4-(5-cyanopyrimidin-2-yl)piperazin-1-yl]-2-oxoethoxy]amino]propan-2-yl]carbamic acid (PubChem CID 174218126) has the molecular formula C15H21N7O4 and a molecular weight of 363.38 g/mol. Its IUPAC name is [(2S)-1-[[2-[4-(5-cyanopyrimidin-2-yl)piperazin-1-yl]-2-oxoethoxy]amino]propan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[[2-[4-(5-cyanopyrimidin-2-yl)piperazin-1-yl]-2-oxoethoxy]amino]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174218126 |
| Molecular Formula | C15H21N7O4 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | [(2S)-1-[[2-[4-(5-cyanopyrimidin-2-yl)piperazin-1-yl]-2-oxoethoxy]amino]propan-2-yl]carbamic acid |
| SMILES | C[C@@H](CNOCC(=O)N1CCN(c2ncc(C#N)cn2)CC1)NC(=O)O |
| InChI | InChI=1S/C15H21N7O4/c1-11(20-15(24)25)7-19-26-10-13(23)21-2-4-22(5-3-21)14-17-8-12(6-16)9-18-14/h8-9,11,19-20H,2-5,7,10H2,1H3,(H,24,25)/t11-/m0/s1 |
| InChIKey | OCXYYCMETMTFDE-NSHDSACASA-N |
| XLogP | -0.83 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|