C18H28N6O2 — CID 170169355
2-[4-[2-(4,4-dimethylpentylamino)oxyacetyl]piperazin-1-yl]pyrimidine-5-carbonitrile (PubChem CID 170169355) has the molecular formula C18H28N6O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[4-[2-(4,4-dimethylpentylamino)oxyacetyl]piperazin-1-yl]pyrimidine-5-carbonitrile.
| Compound Name | 2-[4-[2-(4,4-dimethylpentylamino)oxyacetyl]piperazin-1-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 170169355 |
| Molecular Formula | C18H28N6O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-[4-[2-(4,4-dimethylpentylamino)oxyacetyl]piperazin-1-yl]pyrimidine-5-carbonitrile |
| SMILES | CC(C)(C)CCCNOCC(=O)N1CCN(c2ncc(C#N)cn2)CC1 |
| InChI | InChI=1S/C18H28N6O2/c1-18(2,3)5-4-6-22-26-14-16(25)23-7-9-24(10-8-23)17-20-12-15(11-19)13-21-17/h12-13,22H,4-10,14H2,1-3H3 |
| InChIKey | YCBURWPZSQMOIH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|