C21H22F6N5O5Si — CID 174028457
CID 174028457 (PubChem CID 174028457) has the molecular formula C21H22F6N5O5Si and a molecular weight of 566.51 g/mol.
| Compound Name | CID 174028457 |
|---|---|
| PubChem CID | 174028457 |
| Molecular Formula | C21H22F6N5O5Si |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | — |
| SMILES | C[Si](COCCC(=O)N1CCN2c3ncc(C(F)(F)F)cc3OC[C@@H]2C1)Oc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C21H22F6N5O5Si/c1-38(37-15-8-29-30-19(34)17(15)21(25,26)27)11-35-5-2-16(33)31-3-4-32-13(9-31)10-36-14-6-12(20(22,23)24)7-28-18(14)32/h6-8,13H,2-5,9-11H2,1H3,(H,30,34)/t13-/m0/s1 |
| InChIKey | XRFFBKOJSNUBLB-ZDUSSCGKSA-N |
| XLogP | 2.26 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|