C25H31N5O7 — CID 118525592
tert-butyl 1,3-dioxo-2-[4-(4-prop-2-ynoxyphenyl)piperazine-1-carbonyl]oxy-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate (PubChem CID 118525592) has the molecular formula C25H31N5O7 and a molecular weight of 513.55 g/mol. Its IUPAC name is tert-butyl 1,3-dioxo-2-[4-(4-prop-2-ynoxyphenyl)piperazine-1-carbonyl]oxy-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate.
| Compound Name | tert-butyl 1,3-dioxo-2-[4-(4-prop-2-ynoxyphenyl)piperazine-1-carbonyl]oxy-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 118525592 |
| Molecular Formula | C25H31N5O7 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | tert-butyl 1,3-dioxo-2-[4-(4-prop-2-ynoxyphenyl)piperazine-1-carbonyl]oxy-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate |
| SMILES | C#CCOc1ccc(N2CCN(C(=O)ON3C(=O)C4CN(C(=O)OC(C)(C)C)CCN4C3=O)CC2)cc1 |
| InChI | InChI=1S/C25H31N5O7/c1-5-16-35-19-8-6-18(7-9-19)26-10-12-27(13-11-26)24(34)37-30-21(31)20-17-28(14-15-29(20)22(30)32)23(33)36-25(2,3)4/h1,6-9,20H,10-17H2,2-4H3 |
| InChIKey | AOWBXIFMVWGMPL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 112.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|