C30H44N6O6 — CID 129303173
[7-[[1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]piperidin-4-yl]methyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl] 4-(4-methoxyphenyl)piperazine-1-carboxylate (PubChem CID 129303173) has the molecular formula C30H44N6O6 and a molecular weight of 584.72 g/mol. Its IUPAC name is [7-[[1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]piperidin-4-yl]methyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl] 4-(4-methoxyphenyl)piperazine-1-carboxylate.
| Compound Name | [7-[[1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]piperidin-4-yl]methyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl] 4-(4-methoxyphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 129303173 |
| Molecular Formula | C30H44N6O6 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | [7-[[1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]piperidin-4-yl]methyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-2-yl] 4-(4-methoxyphenyl)piperazine-1-carboxylate |
| SMILES | C=C(OC(C)(C)C)N1CCC(CN2CCN3C(=O)N(OC(=O)N4CCN(c5ccc(OC)cc5)CC4)C(=O)C3C2)CC1 |
| InChI | InChI=1S/C30H44N6O6/c1-22(41-30(2,3)4)32-12-10-23(11-13-32)20-31-14-19-35-26(21-31)27(37)36(28(35)38)42-29(39)34-17-15-33(16-18-34)24-6-8-25(40-5)9-7-24/h6-9,23,26H,1,10-21H2,2-5H3 |
| InChIKey | RTMTYGCBELQELO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|