C23H30N4O5 — CID 46260416
ethyl 4-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate (PubChem CID 46260416) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46260416 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | ethyl 4-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2c(N3CCN(c4ccc(OC)cc4)CC3)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C23H30N4O5/c1-3-32-23(30)27-10-8-16(9-11-27)24-19-20(22(29)21(19)28)26-14-12-25(13-15-26)17-4-6-18(31-2)7-5-17/h4-7,16,24H,3,8-15H2,1-2H3 |
| InChIKey | GMXMKNACHPBDMN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|