C23H37N5O4 — CID 51129464
ethyl 4-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propylcarbamoyl]-1,4-diazepane-1-carboxylate (PubChem CID 51129464) has the molecular formula C23H37N5O4 and a molecular weight of 447.58 g/mol. Its IUPAC name is ethyl 4-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propylcarbamoyl]-1,4-diazepane-1-carboxylate.
| Compound Name | ethyl 4-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propylcarbamoyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 51129464 |
| Molecular Formula | C23H37N5O4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | ethyl 4-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propylcarbamoyl]-1,4-diazepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCN(C(=O)NCCCN2CCN(c3ccc(OC)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H37N5O4/c1-3-32-23(30)28-13-5-12-27(18-19-28)22(29)24-10-4-11-25-14-16-26(17-15-25)20-6-8-21(31-2)9-7-20/h6-9H,3-5,10-19H2,1-2H3,(H,24,29) |
| InChIKey | HXBAWSVDIOMFPO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|