C36H49N3O5 — CID 175959295
tert-butyl 4-[2-[1-[4-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]phenyl]piperidin-4-yl]ethyl]piperidine-1-carboxylate (PubChem CID 175959295) has the molecular formula C36H49N3O5 and a molecular weight of 603.80 g/mol. Its IUPAC name is tert-butyl 4-[2-[1-[4-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]phenyl]piperidin-4-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[1-[4-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]phenyl]piperidin-4-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175959295 |
| Molecular Formula | C36H49N3O5 |
| Molecular Weight | 603.80 g/mol |
| Exact Mass | 603.37 |
| IUPAC Name | tert-butyl 4-[2-[1-[4-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]phenyl]piperidin-4-yl]ethyl]piperidine-1-carboxylate |
| SMILES | COc1ccc(CN2C(=O)CCC(c3ccc(N4CCC(CCC5CCN(C(=O)OC(C)(C)C)CC5)CC4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C36H49N3O5/c1-36(2,3)44-35(42)38-23-19-27(20-24-38)6-5-26-17-21-37(22-18-26)30-11-9-29(10-12-30)32-15-16-33(40)39(34(32)41)25-28-7-13-31(43-4)14-8-28/h7-14,26-27,32H,5-6,15-25H2,1-4H3 |
| InChIKey | BCOSJOBYUYOCFG-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.80 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|