C21H33N3O4 — CID 142698793
tert-butyl 3-hydroxy-4-[4-(4-methoxyphenyl)piperazin-1-yl]piperidine-1-carboxylate (PubChem CID 142698793) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-4-[4-(4-methoxyphenyl)piperazin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-4-[4-(4-methoxyphenyl)piperazin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142698793 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | tert-butyl 3-hydroxy-4-[4-(4-methoxyphenyl)piperazin-1-yl]piperidine-1-carboxylate |
| SMILES | COc1ccc(N2CCN(C3CCN(C(=O)OC(C)(C)C)CC3O)CC2)cc1 |
| InChI | InChI=1S/C21H33N3O4/c1-21(2,3)28-20(26)24-10-9-18(19(25)15-24)23-13-11-22(12-14-23)16-5-7-17(27-4)8-6-16/h5-8,18-19,25H,9-15H2,1-4H3 |
| InChIKey | PICIRCKTXKMCPE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|