C32H38N2O4 — CID 171785575
tert-butyl 4-[4-[6-hydroxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperazine-1-carboxylate (PubChem CID 171785575) has the molecular formula C32H38N2O4 and a molecular weight of 514.67 g/mol. Its IUPAC name is tert-butyl 4-[4-[6-hydroxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[6-hydroxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171785575 |
| Molecular Formula | C32H38N2O4 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | tert-butyl 4-[4-[6-hydroxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(C2CCc3cc(O)ccc3C2c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)cc1 |
| InChI | InChI=1S/C32H38N2O4/c1-32(2,3)38-31(36)34-19-17-33(18-20-34)25-10-5-23(6-11-25)30-28(22-7-13-27(37-4)14-8-22)15-9-24-21-26(35)12-16-29(24)30/h5-8,10-14,16,21,28,30,35H,9,15,17-20H2,1-4H3 |
| InChIKey | DYEIXKWQTDIPDK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|