C26H28N2O — CID 134579787
(5R,6S)-6-phenyl-5-(4-piperazin-1-ylphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 134579787) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is (5R,6S)-6-phenyl-5-(4-piperazin-1-ylphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5R,6S)-6-phenyl-5-(4-piperazin-1-ylphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 134579787 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (5R,6S)-6-phenyl-5-(4-piperazin-1-ylphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | Oc1ccc2c(c1)CC[C@H](c1ccccc1)[C@@H]2c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C26H28N2O/c29-23-11-13-25-21(18-23)8-12-24(19-4-2-1-3-5-19)26(25)20-6-9-22(10-7-20)28-16-14-27-15-17-28/h1-7,9-11,13,18,24,26-27,29H,8,12,14-17H2/t24-,26+/m1/s1 |
| InChIKey | JRJGJUIMMUYSTQ-RSXGOPAZSA-N |
| XLogP | 4.66 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|