C28H29NO3 — CID 164923007
1-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]piperidine-4-carboxylic acid (PubChem CID 164923007) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is 1-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 164923007 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 1-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2ccc(C3c4ccc(O)cc4CCC3c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C28H29NO3/c30-24-11-13-26-22(18-24)8-12-25(19-4-2-1-3-5-19)27(26)20-6-9-23(10-7-20)29-16-14-21(15-17-29)28(31)32/h1-7,9-11,13,18,21,25,27,30H,8,12,14-17H2,(H,31,32) |
| InChIKey | OIPRXFUILVDODR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|