C29H32N2O — CID 164923324
(6S)-5-[4-(2,7-diazaspiro[4.4]nonan-2-yl)phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 164923324) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is (6S)-5-[4-(2,7-diazaspiro[4.4]nonan-2-yl)phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (6S)-5-[4-(2,7-diazaspiro[4.4]nonan-2-yl)phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 164923324 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (6S)-5-[4-(2,7-diazaspiro[4.4]nonan-2-yl)phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | Oc1ccc2c(c1)CC[C@H](c1ccccc1)C2c1ccc(N2CCC3(CCNC3)C2)cc1 |
| InChI | InChI=1S/C29H32N2O/c32-25-11-13-27-23(18-25)8-12-26(21-4-2-1-3-5-21)28(27)22-6-9-24(10-7-22)31-17-15-29(20-31)14-16-30-19-29/h1-7,9-11,13,18,26,28,30,32H,8,12,14-17,19-20H2/t26-,28?,29?/m1/s1 |
| InChIKey | KTFMEZXYZFVIJL-CSJMBUEXSA-N |
| XLogP | 5.44 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|