C31H37BN2O2 — CID 164923078
[(5R,6S)-5-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-yl]boronic acid (PubChem CID 164923078) has the molecular formula C31H37BN2O2 and a molecular weight of 480.46 g/mol. Its IUPAC name is [(5R,6S)-5-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-yl]boronic acid.
| Compound Name | [(5R,6S)-5-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-yl]boronic acid |
|---|---|
| PubChem CID | 164923078 |
| Molecular Formula | C31H37BN2O2 |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | [(5R,6S)-5-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-yl]boronic acid |
| SMILES | OB(O)c1ccc2c(c1)CC[C@H](c1ccccc1)[C@@H]2c1ccc(N2CCC3(CCNCC3)CC2)cc1 |
| InChI | InChI=1S/C31H37BN2O2/c35-32(36)26-9-13-29-25(22-26)8-12-28(23-4-2-1-3-5-23)30(29)24-6-10-27(11-7-24)34-20-16-31(17-21-34)14-18-33-19-15-31/h1-7,9-11,13,22,28,30,33,35-36H,8,12,14-21H2/t28-,30+/m1/s1 |
| InChIKey | ISVUBKSSUKLCIU-DGPALRBDSA-N |
| XLogP | 4.20 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|