C32H38N4 — CID 164923625
5-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-1-methanimidoyl-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-amine (PubChem CID 164923625) has the molecular formula C32H38N4 and a molecular weight of 478.68 g/mol. Its IUPAC name is 5-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-1-methanimidoyl-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-amine.
| Compound Name | 5-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-1-methanimidoyl-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 164923625 |
| Molecular Formula | C32H38N4 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | 5-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]-1-methanimidoyl-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-amine |
| SMILES | [H]/N=C/c1c(N)ccc2c1CCC(c1ccccc1)C2c1ccc(N2CCC3(CCNCC3)CC2)cc1 |
| InChI | InChI=1S/C32H38N4/c33-22-29-27-11-10-26(23-4-2-1-3-5-23)31(28(27)12-13-30(29)34)24-6-8-25(9-7-24)36-20-16-32(17-21-36)14-18-35-19-15-32/h1-9,12-13,22,26,31,33,35H,10-11,14-21,34H2/b33-22+ |
| InChIKey | GCOUQKMQBJVSKU-STKMKYKTSA-N |
| XLogP | 6.10 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|